CAS 132684-60-7 appears in our catalog under these names: Fmoc-Tle-OH, 97%, Fmoc–Tle–OH, Fmoc-L-Tle-OH, Fmoc-L-tert-leucine, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-L-tert-leucine, >98.0%(HPLC)(T). Offered by: Combi-blocks, GLPBio, Iris Biotech, Biosynth, TCI. Available pack sizes: 5g, 100g, 500g, 25g, 50g, 250g, 10g, 1000g.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid (CAS 132684-60-7) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid. InChIKey: VZOHGJIGTNUNNC-GOSISDBHSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | VZOHGJIGTNUNNC-GOSISDBHSA-N |
| SMILES | CC(C)(C)[C@@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)