CAS 198543-64-5 appears in our catalog under these names: Fmoc-D-Tle-OH, 96%, Fmoc–tBu–D–Gly–OH, Fmoc-D-Tle-OH, Fmoc-D-Tle-OH 98%, N-[(9H-Fluoren-9-ylmethoxy)carbonyl]-3-methyl-D-valine, 98%, 98%. Offered by: Combi-blocks, GLPBio, Iris Biotech, Ambeed, Chemat. Available pack sizes: 1g, 25g, 100g, 5g, 10g, 50g, 100 g, 10 g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid (CAS 198543-64-5) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid. InChIKey: VZOHGJIGTNUNNC-SFHVURJKSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | VZOHGJIGTNUNNC-SFHVURJKSA-N |
| SMILES | CC(C)(C)[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)