CAS 143688-83-9 appears in our catalog under these names: Fmoc-D-Ile-OH, 98%, Fmoc-D-Ile-OH (N-Fmoc-D-isoleucine), Fmoc–D–Ile–OPfp, Fmoc-D-Ile-OH, Fmoc-D-Ile-OH, 98.00%. Offered by: Combi-blocks, Chemat Brand, GLPBio, Iris Biotech, Chemat. Available pack sizes: 250mg, 5g, 10g, 25g, 1g, on request, 50mg, 100mg.
(2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid (CAS 143688-83-9) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid. InChIKey: QXVFEIPAZSXRGM-BFUOFWGJSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2R,3R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methylpentanoic acid |
| InChIKey | QXVFEIPAZSXRGM-BFUOFWGJSA-N |
| SMILES | CC[C@@H](C)[C@H](C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)