CAS 186320-21-8 appears in our catalog under these names: Fmoc-dl-tert-leucine, 95%, 2-({((9H-Fluoren-9-yl)methoxy)carbonyl}amino)-3,3-dimethylbutanoic acid, Fmoc-DL-Tle-OH 98%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-dimethylbutanoic acid, 98%, 98%, 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-3,3-dimethylbutanoic acid, 98%. Offered by: Combi-blocks, Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 250mg, 100mg, 5g, 10g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid (CAS 186320-21-8) is a chemical compound with the molecular formula C21H23NO4 and a molecular weight of 353.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid. InChIKey: VZOHGJIGTNUNNC-UHFFFAOYSA-N.
| Molecular formula | C21H23NO4 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-3,3-dimethylbutanoic acid |
| InChIKey | VZOHGJIGTNUNNC-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)