cas: 862283-71-4 — see every product listed under this CAS number, including other names
(3S,4R)-Methyl 4-(4-chlorophenyl)pyrrolidine-3-carboxylate hydrochloride, 97% (CAS 862283-71-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 500mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A730929-5g |
| cas | 862283-71-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 17757.67 Pln | |
| AmBeed | 10g | 21474.88 Pln | |
| Fluorochem | 100mg | 1398.48 Pln | |
| Fluorochem | 250mg | 1825.42 Pln | |
| Fluorochem | 500mg | 2986.47 Pln | |
| Fluorochem | 1g | 4397.43 Pln | |
| Fluorochem | 5g | 12790.31 Pln | |
| Fluorochem | 10g | 21266.49 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
Methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 862283-71-4) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: GAUUDZXLKADUHC-VZXYPILPSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | GAUUDZXLKADUHC-VZXYPILPSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)