CAS 1807941-55-4 appears in our catalog under these names: trans-Methyl 4-(4-chlorophenyl)pyrrolidine-3-carboxylate hydrochloride, 97%, 97%, rel-Methyl(3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylatehydrochloride, 97%. Offered by: Chemat, Fluorochem. Available pack sizes: 50mg, 100mg, 1g, 250mg, 5g.
Methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 1807941-55-4) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: GAUUDZXLKADUHC-VZXYPILPSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | GAUUDZXLKADUHC-VZXYPILPSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)