CAS 862283-71-4 appears in our catalog under these names: (3S,4R)-Methyl 4-(4-chlorophenyl)pyrrolidine-3-carboxylate hydrochloride, 97%, methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate hydrochloride, 97%, 97%. Offered by: AmBeed, Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g.
Methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride (CAS 862283-71-4) is a chemical compound with the molecular formula C12H15Cl2NO2 and a molecular weight of 276.16 g/mol. IUPAC name: methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride. InChIKey: GAUUDZXLKADUHC-VZXYPILPSA-N.
| Molecular formula | C12H15Cl2NO2 |
|---|---|
| Molecular weight | 276.16 g/mol |
| IUPAC name | methyl (3S,4R)-4-(4-chlorophenyl)pyrrolidine-3-carboxylate;hydrochloride |
| InChIKey | GAUUDZXLKADUHC-VZXYPILPSA-N |
| SMILES | COC(=O)[C@@H]1CNC[C@H]1C2=CC=C(C=C2)Cl.Cl |
Computed by PubChem (NCBI)