cas: 1072951-81-5 — see every product listed under this CAS number, including other names
(4'-(Isopentyloxy)-[1,1'-biphenyl]-4-yl)boronic acid 95% (CAS 1072951-81-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A150443-250mg |
| cas | 1072951-81-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 298.06 Pln | |
| Ambeed | 5g | 943.31 Pln | |
| Ambeed | 25g | 3129.38 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A150443 |
[4-[4-(3-methylbutoxy)phenyl]phenyl]boronic acid (CAS 1072951-81-5) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [4-[4-(3-methylbutoxy)phenyl]phenyl]boronic acid. InChIKey: DCGWYEOALFPYHU-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [4-[4-(3-methylbutoxy)phenyl]phenyl]boronic acid |
| InChIKey | DCGWYEOALFPYHU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCCC(C)C)(O)O |
Computed by PubChem (NCBI)