CAS 1072951-74-6 appears in our catalog under these names: 3-[(2'-Isopropyl-5'-methylphenoxy)methyl]phenylboronic acid, 95%, 3-[(2'-Isopropyl-5'-methylphenoxy)methyl]phenylboronic acid, 97%(LC-MS),RG, 97%(LC-MS),RG, (3-((2-Isopropyl-5-methylphenoxy)methyl)phenyl)boronic acid, 97%(LC-MS),RG, (3-((2-Isopropyl-5-methylphenoxy)methyl)phenyl)boronic acid 95%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg, 25g.
[3-[(5-methyl-2-propan-2-ylphenoxy)methyl]phenyl]boronic acid (CAS 1072951-74-6) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [3-[(5-methyl-2-propan-2-ylphenoxy)methyl]phenyl]boronic acid. InChIKey: AABBYGNTCONFJV-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [3-[(5-methyl-2-propan-2-ylphenoxy)methyl]phenyl]boronic acid |
| InChIKey | AABBYGNTCONFJV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)COC2=C(C=CC(=C2)C)C(C)C)(O)O |
Computed by PubChem (NCBI)