CAS 936565-47-8 appears in our catalog under these names: (4-[(4-tert-Butylphenyl)methoxy]phenyl)boronic acid, 95%, (4-(4-tert-Butylphenylmethoxy)phenyl)boronic acid, 95-<97%, (4–((4–Tert–butylphenyl)methoxy)phenyl)boronic acid, (4-((4-(tert-Butyl)benzyl)oxy)phenyl)boronic acid, 95%, 95%, (4-((4-(Tert-butyl)benzyl)oxy)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Hoffman Fine Chemicals, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 2,5g, 5g, 10g, 25g, 50g, 50mg.
[4-[(4-tert-butylphenyl)methoxy]phenyl]boronic acid (CAS 936565-47-8) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [4-[(4-tert-butylphenyl)methoxy]phenyl]boronic acid. InChIKey: SOEORXWYZSPZCL-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [4-[(4-tert-butylphenyl)methoxy]phenyl]boronic acid |
| InChIKey | SOEORXWYZSPZCL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)OCC2=CC=C(C=C2)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)