CAS 1313760-38-1 appears in our catalog under these names: (3-[(4-tert-Butylphenyl)methoxy]phenyl)boronic acid, 95%, (3-((4-(tert-Butyl)benzyl)oxy)phenyl)boronic acid, 98%, 3–(4–Tert–butylphenyloxy) phenylboronic acid, (3-((4-(tert-Butyl)benzyl)oxy)phenyl)boronic acid, 95%, 95%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat. Available pack sizes: 5g, 250mg, 1g.
[3-[(4-tert-butylphenyl)methoxy]phenyl]boronic acid (CAS 1313760-38-1) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [3-[(4-tert-butylphenyl)methoxy]phenyl]boronic acid. InChIKey: VVAMKIHTHYBXQU-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [3-[(4-tert-butylphenyl)methoxy]phenyl]boronic acid |
| InChIKey | VVAMKIHTHYBXQU-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)OCC2=CC=C(C=C2)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)