CAS 1072951-81-5 appears in our catalog under these names: 4-(4'-Isopentyloxyphenyl)phenylboronic acid, 95%, 4–(4′–Isopentyloxyphenyl)phenylboronic acid, (4'-(Isopentyloxy)-[1,1'-biphenyl]-4-yl)boronic acid 95%, 4-(4'-ISOPENTYLOXYPHENYL)PHENYLBORONIC ACID, 95%, 95%, (4'-(Isopentyloxy)-[1,1'-biphenyl]-4-yl)boronic acid. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 25g.
[4-[4-(3-methylbutoxy)phenyl]phenyl]boronic acid (CAS 1072951-81-5) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [4-[4-(3-methylbutoxy)phenyl]phenyl]boronic acid. InChIKey: DCGWYEOALFPYHU-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [4-[4-(3-methylbutoxy)phenyl]phenyl]boronic acid |
| InChIKey | DCGWYEOALFPYHU-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCCC(C)C)(O)O |
Computed by PubChem (NCBI)