CAS 1220625-04-6 appears in our catalog under these names: 2-(Benzyloxy)-5-t-butylphenylboronic acid, 98%, 2-(Benzyloxy)-5-t-butylphenylboronic acid, 95%, 95%, (2-(Benzyloxy)-5-(tert-butyl)phenyl)boronic acid, 95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 1g, 10g, 5g, 100mg, 250mg.
(5-tert-butyl-2-phenylmethoxyphenyl)boronic acid (CAS 1220625-04-6) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: (5-tert-butyl-2-phenylmethoxyphenyl)boronic acid. InChIKey: LRTVCRYAQQIJBL-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | (5-tert-butyl-2-phenylmethoxyphenyl)boronic acid |
| InChIKey | LRTVCRYAQQIJBL-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)C(C)(C)C)OCC2=CC=CC=C2)(O)O |
Computed by PubChem (NCBI)