CAS 1072951-87-1 appears in our catalog under these names: 2-[(2-Isopropyl-5-methylphenoxy)methyl]phenylboronic acid, 98%, 2-[(2-Isopropyl-5-methylphenoxy)methyl]phenylboronic acid, 98%, 98%, (2-((2-Isopropyl-5-methylphenoxy)methyl)phenyl)boronic acid, 98%. Offered by: Combi-blocks, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 5g, 250mg.
[2-[(5-methyl-2-propan-2-ylphenoxy)methyl]phenyl]boronic acid (CAS 1072951-87-1) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [2-[(5-methyl-2-propan-2-ylphenoxy)methyl]phenyl]boronic acid. InChIKey: JDYAGWNUTBEZCI-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [2-[(5-methyl-2-propan-2-ylphenoxy)methyl]phenyl]boronic acid |
| InChIKey | JDYAGWNUTBEZCI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1COC2=C(C=CC(=C2)C)C(C)C)(O)O |
Computed by PubChem (NCBI)