CAS 158937-25-8 appears in our catalog under these names: (4‚Ä≤-(Pentyloxy)(1,1‚Ä≤-biphenyl)-4-yl)boronic acid, 95-<97%, (4‚Ä≤-(Pentyloxy)(1,1‚Ä≤-biphenyl)-4-yl)boronic acid, ≥97-<99%, 4'–Pentyloxybiphenyl–4–boronic Acid (contains varying amounts of Anhydride), 4'-Pentyloxybiphenyl-4-boronic Acid (contains varying amounts of Anhydride), (4'-(Pentyloxy)-[1,1'-biphenyl]-4-yl)boronic acid, 95%, 95%. Offered by: Hoffman Fine Chemicals, GLPBio, TCI, Chemat, Fluorochem. Available pack sizes: 50g, 100g, 200g, 300g, 400g, 500g, 25g, 5g.
[4-(4-pentoxyphenyl)phenyl]boronic acid (CAS 158937-25-8) is a chemical compound with the molecular formula C17H21BO3 and a molecular weight of 284.2 g/mol. IUPAC name: [4-(4-pentoxyphenyl)phenyl]boronic acid. InChIKey: DBDYXLZXTNHAFI-UHFFFAOYSA-N.
| Molecular formula | C17H21BO3 |
|---|---|
| Molecular weight | 284.2 g/mol |
| IUPAC name | [4-(4-pentoxyphenyl)phenyl]boronic acid |
| InChIKey | DBDYXLZXTNHAFI-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCCCCC)(O)O |
Computed by PubChem (NCBI)