cas: 182344-29-2 — see every product listed under this CAS number, including other names
(4'-Ethoxy-[1,1'-biphenyl]-4-yl)boronic acid (CAS 182344-29-2) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F318046-5G |
| cas | 182344-29-2 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 1434.93 Pln |
| delivery time | 3-4 weeks |
|---|
[4-(4-ethoxyphenyl)phenyl]boronic acid (CAS 182344-29-2) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: [4-(4-ethoxyphenyl)phenyl]boronic acid. InChIKey: ZFFXATWYKJBSCC-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | [4-(4-ethoxyphenyl)phenyl]boronic acid |
| InChIKey | ZFFXATWYKJBSCC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OCC)(O)O |
Computed by PubChem (NCBI)