cas: 870717-98-9 — see every product listed under this CAS number, including other names
(4'-Isopropoxy-[1,1'-biphenyl]-4-yl)boronic acid, 97% (CAS 870717-98-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338291-250MG |
| cas | 870717-98-9 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 263.47 Pln | |
| Fluorochem | 1g | 633.13 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-(4-propan-2-yloxyphenyl)phenyl]boronic acid (CAS 870717-98-9) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: [4-(4-propan-2-yloxyphenyl)phenyl]boronic acid. InChIKey: NBOVAIFWBASNLS-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | [4-(4-propan-2-yloxyphenyl)phenyl]boronic acid |
| InChIKey | NBOVAIFWBASNLS-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2=CC=C(C=C2)OC(C)C)(O)O |
Computed by PubChem (NCBI)