Products 2760558-35-6
CAS 2760558-35-6 is the registry number for 1-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)prop-2-yn-1-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-yn-1-one (CAS 2760558-35-6) is a chemical compound with the molecular formula C15H17BO3 and a molecular weight of 256.11 g/mol. IUPAC name: 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-yn-1-one. InChIKey: AIIZEYFJPJUACH-UHFFFAOYSA-N.
| Molecular formula | C15H17BO3 |
|---|---|
| Molecular weight | 256.11 g/mol |
| IUPAC name | 1-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]prop-2-yn-1-one |
| InChIKey | AIIZEYFJPJUACH-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)C(=O)C#C |
Computed by PubChem (NCBI)