cas: 114772-78-0 — see every product listed under this CAS number, including other names
(4'-METHYL-[1,1'-BIPHENYL]-2-YL)METHANOL, 97% (CAS 114772-78-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F386323-1G |
| cas | 114772-78-0 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 1539.06 Pln | |
| Fluorochem | 5g | 4475.53 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[2-(4-methylphenyl)phenyl]methanol (CAS 114772-78-0) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: [2-(4-methylphenyl)phenyl]methanol. InChIKey: HZKTVZWAAJNVPE-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | [2-(4-methylphenyl)phenyl]methanol |
| InChIKey | HZKTVZWAAJNVPE-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)C2=CC=CC=C2CO |
Computed by PubChem (NCBI)