CAS 773872-33-6 appears in our catalog under these names: [4-(3-methylphenyl)phenyl]methanol, 95%, (3'-Methyl-(1,1'-biphenyl)-4-yl)methanol, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 25g.
[4-(3-methylphenyl)phenyl]methanol (CAS 773872-33-6) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: [4-(3-methylphenyl)phenyl]methanol. InChIKey: AWWJGVBHUYQLEJ-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | [4-(3-methylphenyl)phenyl]methanol |
| InChIKey | AWWJGVBHUYQLEJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=C(C=C2)CO |
Computed by PubChem (NCBI)