Products 1279015-98-3
CAS 1279015-98-3 is the registry number for 2-Ethyl-[1,1'-biphenyl]-4-ol, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 1g, 250mg.
3-ethyl-4-phenylphenol (CAS 1279015-98-3) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 3-ethyl-4-phenylphenol. InChIKey: UMGPLPGVYGQJQX-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 3-ethyl-4-phenylphenol |
| InChIKey | UMGPLPGVYGQJQX-UHFFFAOYSA-N |
| SMILES | CCC1=C(C=CC(=C1)O)C2=CC=CC=C2 |
Computed by PubChem (NCBI)