Products 1579-40-4
CAS 1579-40-4 appears in our catalog under these names: 4-Tolyl Ether, 98%, 98%, Di-p-tolyl ether, 98%, Di–p–tolyl Ether, Di-p-tolyl ether, Di-p-tolyl Ether, >98.0%(GC). Offered by: Chemat, Combi-blocks, GLPBio, Biosynth, TCI. Available pack sizes: 5g, 25g, 100g, 1g, 50g, 10g.
1-methyl-4-(4-methylphenoxy)benzene (CAS 1579-40-4) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 1-methyl-4-(4-methylphenoxy)benzene. InChIKey: YWYHGNUFMPSTTR-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-methyl-4-(4-methylphenoxy)benzene |
| InChIKey | YWYHGNUFMPSTTR-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)OC2=CC=C(C=C2)C |
Computed by PubChem (NCBI)
Synonyms:
p-Tolyl ether, Benzene, 1,1'-oxybis[4-methyl-, 1,1'-Oxybis(4-methylbenzene), Benzene, 1,1'-oxybis(4-methyl-, 1,1'-Oxybis[4-methylbenzene], Benzene, 1,1'-oxybis*4-methyl-, p-Tolyl ether (6CI,7CI,8CI), InChI=1/C14H14O/c1-11-3-7-13(8-4-11)15-14-9-5-12(2)6-10-14/h3-10H,1-2H, YWYHGNUFMPSTTR-UHFFFAOYSA-N, Di-p-tolyl ether