CAS 33675-75-1 appears in our catalog under these names: 3-Phenethyl-phenol, 95%, 3–Phenethylphenol, 3-Phenethyl-phenol, 3-Phenethylphenol 95%, 3-PHENETHYL-PHENOL, 95%, 95%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg.
3-(2-phenylethyl)phenol (CAS 33675-75-1) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 3-(2-phenylethyl)phenol. InChIKey: AIHZDRMFOVBNAV-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 3-(2-phenylethyl)phenol |
| InChIKey | AIHZDRMFOVBNAV-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CCC2=CC(=CC=C2)O |
Computed by PubChem (NCBI)