CAS 614-29-9 appears in our catalog under these names: 1,2-Diphenylethan-1-ol, 95%, 1,2-Diphenylethanol, 1,2-Diphenylethan-1-ol, 1,2-Diphenylethanol, 98%, 98%, 1,2-DIPHENYLETHAN-1-OL, 98%. Offered by: Combi-blocks, TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 1g, 250mg, 100mg, 500mg, 50mg, 2,5g.
1,2-diphenylethanol (CAS 614-29-9) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 1,2-diphenylethanol. InChIKey: GBGXVCNOKWAMIP-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1,2-diphenylethanol |
| InChIKey | GBGXVCNOKWAMIP-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CC(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)