CAS 17171-17-4 appears in our catalog under these names: 4-Methoxy-3'-methylbiphenyl, 95%, 4'-Methoxy-3-methylbiphenyl, 95-<97%. Offered by: Combi-blocks, Hoffman Fine Chemicals. Available pack sizes: 5g, 10g, 25g, 1g, 250mg, 2,5g, 50g.
1-methoxy-4-(3-methylphenyl)benzene (CAS 17171-17-4) is a chemical compound with the molecular formula C14H14O and a molecular weight of 198.26 g/mol. IUPAC name: 1-methoxy-4-(3-methylphenyl)benzene. InChIKey: PGEFXSPLFJLFBA-UHFFFAOYSA-N.
| Molecular formula | C14H14O |
|---|---|
| Molecular weight | 198.26 g/mol |
| IUPAC name | 1-methoxy-4-(3-methylphenyl)benzene |
| InChIKey | PGEFXSPLFJLFBA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)