cas: 2096334-34-6 — see every product listed under this CAS number, including other names
(4,5-Difluoro-2-(methoxycarbonyl)phenyl)boronic acid, 97% (CAS 2096334-34-6) is a chemical reagent available from Chemat. Available pack sizes: 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A188342-5g |
| cas | 2096334-34-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 8363.74 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(4,5-difluoro-2-methoxycarbonylphenyl)boronic acid (CAS 2096334-34-6) is a chemical compound with the molecular formula C8H7BF2O4 and a molecular weight of 215.95 g/mol. IUPAC name: (4,5-difluoro-2-methoxycarbonylphenyl)boronic acid. InChIKey: FKBKLXXNCMSJMQ-UHFFFAOYSA-N.
| Molecular formula | C8H7BF2O4 |
|---|---|
| Molecular weight | 215.95 g/mol |
| IUPAC name | (4,5-difluoro-2-methoxycarbonylphenyl)boronic acid |
| InChIKey | FKBKLXXNCMSJMQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C(=O)OC)F)F)(O)O |
Computed by PubChem (NCBI)