cas: 1416244-48-8 — see every product listed under this CAS number, including other names
(4,5-Difluoro-2-methylphenyl)boronic acid, 98%, 98% (CAS 1416244-48-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112GOM-100mg |
| cas | 1416244-48-8 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 184.40 Pln | |
| Chemat | 5g | 626.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(4,5-difluoro-2-methylphenyl)boronic acid (CAS 1416244-48-8) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (4,5-difluoro-2-methylphenyl)boronic acid. InChIKey: RUSKIGNGLQRANK-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (4,5-difluoro-2-methylphenyl)boronic acid |
| InChIKey | RUSKIGNGLQRANK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)F)(O)O |
Computed by PubChem (NCBI)