cas: 1416244-48-8 — see every product listed under this CAS number, including other names
(4,5-Difluoro-2-methylphenyl)boronic acid, 98% (CAS 1416244-48-8) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F788065-1G |
| cas | 1416244-48-8 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 200.99 Pln | |
| Fluorochem | 5g | 789.32 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(4,5-difluoro-2-methylphenyl)boronic acid (CAS 1416244-48-8) is a chemical compound with the molecular formula C7H7BF2O2 and a molecular weight of 171.94 g/mol. IUPAC name: (4,5-difluoro-2-methylphenyl)boronic acid. InChIKey: RUSKIGNGLQRANK-UHFFFAOYSA-N.
| Molecular formula | C7H7BF2O2 |
|---|---|
| Molecular weight | 171.94 g/mol |
| IUPAC name | (4,5-difluoro-2-methylphenyl)boronic acid |
| InChIKey | RUSKIGNGLQRANK-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1C)F)F)(O)O |
Computed by PubChem (NCBI)