cas: 1449132-62-0 — see every product listed under this CAS number, including other names
(4-((4-methylpiperidin-1-yl)sulfonyl)phenyl)boronic acid, 95%, 95% (CAS 1449132-62-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11ARNV-100mg |
| cas | 1449132-62-0 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 818.00 Pln | |
| Chemat | 250mg | 1576.40 Pln | |
| Chemat | 1g | 4197.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid (CAS 1449132-62-0) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: [4-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid. InChIKey: ARVNTVVSGLEIAQ-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | [4-(4-methylpiperidin-1-yl)sulfonylphenyl]boronic acid |
| InChIKey | ARVNTVVSGLEIAQ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)S(=O)(=O)N2CCC(CC2)C)(O)O |
Computed by PubChem (NCBI)