CAS 1704095-47-5 is the registry number for (3–(N–Cyclopentylsulfamoyl)– 4–methylphenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 500mg.
[3-(cyclopentylsulfamoyl)-4-methylphenyl]boronic acid (CAS 1704095-47-5) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: [3-(cyclopentylsulfamoyl)-4-methylphenyl]boronic acid. InChIKey: UHZICVSZSUWKAV-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | [3-(cyclopentylsulfamoyl)-4-methylphenyl]boronic acid |
| InChIKey | UHZICVSZSUWKAV-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)C)S(=O)(=O)NC2CCCC2)(O)O |
Computed by PubChem (NCBI)