CAS 2223029-34-1 is the registry number for Ethyl 5–(4,4,5,5–tetramethyl–1,3,2–dioxaborolan–2–yl)thiazole–2–carboxylate. Offered by: GLPBio. Available pack sizes: 25mg, 5mg.
Ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole-2-carboxylate (CAS 2223029-34-1) is a chemical compound with the molecular formula C12H18BNO4S and a molecular weight of 283.16 g/mol. IUPAC name: ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole-2-carboxylate. InChIKey: QBXXOUJIFSJHLC-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO4S |
|---|---|
| Molecular weight | 283.16 g/mol |
| IUPAC name | ethyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1,3-thiazole-2-carboxylate |
| InChIKey | QBXXOUJIFSJHLC-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CN=C(S2)C(=O)OCC |
Computed by PubChem (NCBI)