cas: 1334173-89-5 — see every product listed under this CAS number, including other names
(4-((Dimethylamino)methyl)-3-fluorophenyl)boronic acid, 97% (CAS 1334173-89-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 100mg, 250mg, 1g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A712919-5g |
| cas | 1334173-89-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 10362.31 Pln | |
| AmBeed | 10g | 17568.88 Pln | |
| Fluorochem | 100mg | 534.20 Pln | |
| Fluorochem | 250mg | 685.19 Pln | |
| Fluorochem | 1g | 2049.30 Pln | |
| Fluorochem | 5g | 6454.00 Pln | |
| Fluorochem | 10g | 10947.20 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-[(dimethylamino)methyl]-3-fluorophenyl]boronic acid (CAS 1334173-89-5) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 197.02 g/mol. IUPAC name: [4-[(dimethylamino)methyl]-3-fluorophenyl]boronic acid. InChIKey: BZGKUSJVFIQRST-UHFFFAOYSA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | [4-[(dimethylamino)methyl]-3-fluorophenyl]boronic acid |
| InChIKey | BZGKUSJVFIQRST-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN(C)C)F)(O)O |
Computed by PubChem (NCBI)