CAS 1292755-46-4 is the registry number for (2–((Dimethylamino)methyl)–5–fluorophenyl)boronic acid. Offered by: GLPBio. Available pack sizes: 1g.
[2-[(dimethylamino)methyl]-5-fluorophenyl]boronic acid (CAS 1292755-46-4) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 197.02 g/mol. IUPAC name: [2-[(dimethylamino)methyl]-5-fluorophenyl]boronic acid. InChIKey: XZQHDVIHVSXLQW-UHFFFAOYSA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | [2-[(dimethylamino)methyl]-5-fluorophenyl]boronic acid |
| InChIKey | XZQHDVIHVSXLQW-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1)F)CN(C)C)(O)O |
Computed by PubChem (NCBI)