CAS 1334173-89-5 appears in our catalog under these names: 4-[(dimethylamino)methyl]-3-fluorophenylboronic acid, 95%, (4-((Dimethylamino)methyl)-3-fluorophenyl)boronic acid, 97%, (4–((dimethylamino)methyl)–3–fluorophenyl)boronic acid, 4-((diMethylaMino)Methyl)-3-fluorophenylboronic acid, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 10g, 100mg.
[4-[(dimethylamino)methyl]-3-fluorophenyl]boronic acid (CAS 1334173-89-5) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 197.02 g/mol. IUPAC name: [4-[(dimethylamino)methyl]-3-fluorophenyl]boronic acid. InChIKey: BZGKUSJVFIQRST-UHFFFAOYSA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | [4-[(dimethylamino)methyl]-3-fluorophenyl]boronic acid |
| InChIKey | BZGKUSJVFIQRST-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)CN(C)C)F)(O)O |
Computed by PubChem (NCBI)