CAS 1061223-43-5 appears in our catalog under these names: (2–((Dimethylamino)methyl)–4–fluorophenyl)boronic acid, (2-((dimethylamino)methyl)-4-fluorophenyl)boronic acid, 98+%. Offered by: GLPBio, Ambeed. Available pack sizes: 250mg, 500mg, 1g.
[2-[(dimethylamino)methyl]-4-fluorophenyl]boronic acid (CAS 1061223-43-5) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 197.02 g/mol. IUPAC name: [2-[(dimethylamino)methyl]-4-fluorophenyl]boronic acid. InChIKey: ZDZNQSHWAKMXIF-UHFFFAOYSA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | [2-[(dimethylamino)methyl]-4-fluorophenyl]boronic acid |
| InChIKey | ZDZNQSHWAKMXIF-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1)F)CN(C)C)(O)O |
Computed by PubChem (NCBI)