CAS 1704063-96-6 is the registry number for {3-[(Dimethylamino)methyl]-4-fluorophenyl}boronic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.
[3-[(dimethylamino)methyl]-4-fluorophenyl]boronic acid (CAS 1704063-96-6) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 197.02 g/mol. IUPAC name: [3-[(dimethylamino)methyl]-4-fluorophenyl]boronic acid. InChIKey: DOELLJCGVGGUBJ-UHFFFAOYSA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | [3-[(dimethylamino)methyl]-4-fluorophenyl]boronic acid |
| InChIKey | DOELLJCGVGGUBJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)F)CN(C)C)(O)O |
Computed by PubChem (NCBI)