CAS 2225175-55-1 is the registry number for 4–Fluoro–2–(tert–butyl)pyridine–5–boronic acid. Offered by: GLPBio. Available pack sizes: 100mg, 25mg, 5mg.
(6-tert-butyl-4-fluoro-3-pyridinyl)boronic acid (CAS 2225175-55-1) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 197.02 g/mol. IUPAC name: (6-tert-butyl-4-fluoro-3-pyridinyl)boronic acid. InChIKey: PMNKIKAPDFPTAV-UHFFFAOYSA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | (6-tert-butyl-4-fluoro-3-pyridinyl)boronic acid |
| InChIKey | PMNKIKAPDFPTAV-UHFFFAOYSA-N |
| SMILES | B(C1=CN=C(C=C1F)C(C)(C)C)(O)O |
Computed by PubChem (NCBI)