CAS 2121513-48-0 appears in our catalog under these names: 3-(N,N-Dimethylaminomethyl)-2-fluorophenylboronic acid, 95%, 3-(N,N-dimethylaminomethyl)-2-fluorophenylboronic acid, ≥95%, ≥95%, 3-(N,N-dimethylaminomethyl)-2-fluorophenylboronic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g, 250mg.
[3-[(dimethylamino)methyl]-2-fluorophenyl]boronic acid (CAS 2121513-48-0) is a chemical compound with the molecular formula C9H13BFNO2 and a molecular weight of 197.02 g/mol. IUPAC name: [3-[(dimethylamino)methyl]-2-fluorophenyl]boronic acid. InChIKey: QUKBSSZJZFXHOB-UHFFFAOYSA-N.
| Molecular formula | C9H13BFNO2 |
|---|---|
| Molecular weight | 197.02 g/mol |
| IUPAC name | [3-[(dimethylamino)methyl]-2-fluorophenyl]boronic acid |
| InChIKey | QUKBSSZJZFXHOB-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=CC=C1)CN(C)C)F)(O)O |
Computed by PubChem (NCBI)