cas: 1217501-10-4 — see every product listed under this CAS number, including other names
(4-(1-(Hydroxymethyl)cyclopropyl)phenyl)boronic acid, 97% (CAS 1217501-10-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F216280-100MG |
| cas | 1217501-10-4 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 294.71 Pln | |
| Fluorochem | 250mg | 435.28 Pln | |
| Fluorochem | 1g | 1190.22 Pln | |
| Fluorochem | 5g | 3824.71 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[4-[1-(hydroxymethyl)cyclopropyl]phenyl]boronic acid (CAS 1217501-10-4) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: [4-[1-(hydroxymethyl)cyclopropyl]phenyl]boronic acid. InChIKey: RSZPBFYCGLSBAF-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | [4-[1-(hydroxymethyl)cyclopropyl]phenyl]boronic acid |
| InChIKey | RSZPBFYCGLSBAF-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CC2)CO)(O)O |
Computed by PubChem (NCBI)