CAS 1467062-11-8 appears in our catalog under these names: (4-(1-Hydroxy-cyclobutyl)phenyl)boronic acid, 95-<97%, (4-(1-Hydroxycyclobutyl)phenyl)boronic acid. Offered by: Hoffman Fine Chemicals, Biosynth. Available pack sizes: 250mg, 500mg, 1g, 2,5g, 5g, 10g, 0,5g, 50mg.
[4-(1-hydroxycyclobutyl)phenyl]boronic acid (CAS 1467062-11-8) is a chemical compound with the molecular formula C10H13BO3 and a molecular weight of 192.02 g/mol. IUPAC name: [4-(1-hydroxycyclobutyl)phenyl]boronic acid. InChIKey: GVZKTTKKEWDYQO-UHFFFAOYSA-N.
| Molecular formula | C10H13BO3 |
|---|---|
| Molecular weight | 192.02 g/mol |
| IUPAC name | [4-(1-hydroxycyclobutyl)phenyl]boronic acid |
| InChIKey | GVZKTTKKEWDYQO-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C2(CCC2)O)(O)O |
Computed by PubChem (NCBI)