(4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, 97%
cas: 454185-96-7 — see every product listed under this CAS number, including other names
(4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, 97% (CAS 454185-96-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g, 100mg. Offered by: Ambeed, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A319642-250mg |
| cas | 454185-96-7 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 459.38 Pln | |
| Ambeed | 5g | 1633.06 Pln | |
| Ambeed | 10g | 2606.50 Pln | |
| Ambeed | 25g | 5165.25 Pln | |
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 803.60 Pln | |
| Chemat | 10g | 1547.60 Pln | |
| Chemat | 25g | 3299.60 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[4-(2-methoxy-2-oxoethyl)phenyl]boronic acid (CAS 454185-96-7) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: [4-(2-methoxy-2-oxoethyl)phenyl]boronic acid. InChIKey: CKXOGMXYISAZGN-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | [4-(2-methoxy-2-oxoethyl)phenyl]boronic acid |
| InChIKey | CKXOGMXYISAZGN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, [4-(2-methoxy-2-oxoethyl)phenyl]boronic acid, 4-(2-Methoxy-2-oxoethyl)phenylboronic Acid, (4-Methoxycarbonylmethyl)phenylboronic acid, (4-Methoxycarbonylmethylphenyl)boronic acid, Methyl (4, Methyl (4-boronophenyl)acetate, (4-(2-Methoxy-2-oxoethyl)phenyl)boronicacid