Products 454185-96-7
CAS 454185-96-7 appears in our catalog under these names: (4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, 95-<97%, (4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, ≥97-<99%, 4–(2–Methoxy–2–oxoethyl)phenylboronic Acid, (4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, 95%, (4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, 97%. Offered by: Hoffman Fine Chemicals, GLPBio, Fluorochem, Ambeed, Chemat. Available pack sizes: 10g, 25g, 50g, 100g, 200g, 1g, 250mg, 2.5g.
[4-(2-methoxy-2-oxoethyl)phenyl]boronic acid (CAS 454185-96-7) is a chemical compound with the molecular formula C9H11BO4 and a molecular weight of 193.99 g/mol. IUPAC name: [4-(2-methoxy-2-oxoethyl)phenyl]boronic acid. InChIKey: CKXOGMXYISAZGN-UHFFFAOYSA-N.
| Molecular formula | C9H11BO4 |
|---|---|
| Molecular weight | 193.99 g/mol |
| IUPAC name | [4-(2-methoxy-2-oxoethyl)phenyl]boronic acid |
| InChIKey | CKXOGMXYISAZGN-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CC(=O)OC)(O)O |
Computed by PubChem (NCBI)
Synonyms:
(4-(2-Methoxy-2-oxoethyl)phenyl)boronic acid, [4-(2-methoxy-2-oxoethyl)phenyl]boronic acid, 4-(2-Methoxy-2-oxoethyl)phenylboronic Acid, (4-Methoxycarbonylmethyl)phenylboronic acid, (4-Methoxycarbonylmethylphenyl)boronic acid, Methyl (4, Methyl (4-boronophenyl)acetate, (4-(2-Methoxy-2-oxoethyl)phenyl)boronicacid