CAS 34176-47-1 is the registry number for 5-Ethyl-4-phenyl-1,3-thiazol-2-amine, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 5g, 1g.
5-ethyl-4-phenyl-1,3-thiazol-2-amine (CAS 34176-47-1) is a chemical compound with the molecular formula C11H12N2S and a molecular weight of 204.29 g/mol. IUPAC name: 5-ethyl-4-phenyl-1,3-thiazol-2-amine. InChIKey: JPFFDVPXYBZEPP-UHFFFAOYSA-N.
| Molecular formula | C11H12N2S |
|---|---|
| Molecular weight | 204.29 g/mol |
| IUPAC name | 5-ethyl-4-phenyl-1,3-thiazol-2-amine |
| InChIKey | JPFFDVPXYBZEPP-UHFFFAOYSA-N |
| SMILES | CCC1=C(N=C(S1)N)C2=CC=CC=C2 |
Computed by PubChem (NCBI)