(4-(Benzyloxy)-2,6-difluorophenyl)boronic acid 95%
cas: 156635-89-1 — see every product listed under this CAS number, including other names
(4-(Benzyloxy)-2,6-difluorophenyl)boronic acid 95% (CAS 156635-89-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A191434-250mg |
| cas | 156635-89-1 |
| size | 250mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 203.50 Pln | |
| Ambeed | 1g | 231.31 Pln | |
| Ambeed | 5g | 642.94 Pln | |
| Ambeed | 10g | 1121.31 Pln | |
| Ambeed | 25g | 1660.88 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A191434 |
(2,6-difluoro-4-phenylmethoxyphenyl)boronic acid (CAS 156635-89-1) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: CDIXTACVWOYKES-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | CDIXTACVWOYKES-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Benzyloxy-2,6-difluorophenylboronic acid, (4-(Benzyloxy)-2,6-difluorophenyl)boronic acid, (4-(Benzyloxy)-2,6-difluorophenyl)boronicacid, (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid, [4-(Benzyloxy)-2,6-difluorophenyl]boronic acid, Boronic acid, [2,6-difluoro-4-(phenylmethoxy)phenyl]- (9CI), 4-(benzyloxy)-2,6-difluorophenylboronic acid, (4-Benzyloxy-2,6-difluoro-phenyl)boronic acid