4-Benzyloxy-2,6-difluorophenylboronic acid, 97%, 97%
cas: 156635-89-1 — see every product listed under this CAS number, including other names
4-Benzyloxy-2,6-difluorophenylboronic acid, 97%, 97% (CAS 156635-89-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112OVA-100mg |
| cas | 156635-89-1 |
| size | 100mg |
| availability | 15g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 88.40 Pln | |
| Chemat | 250mg | 112.40 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 544.40 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2,6-difluoro-4-phenylmethoxyphenyl)boronic acid (CAS 156635-89-1) is a chemical compound with the molecular formula C13H11BF2O3 and a molecular weight of 264.03 g/mol. IUPAC name: (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid. InChIKey: CDIXTACVWOYKES-UHFFFAOYSA-N.
| Molecular formula | C13H11BF2O3 |
|---|---|
| Molecular weight | 264.03 g/mol |
| IUPAC name | (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | CDIXTACVWOYKES-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=C(C=C1F)OCC2=CC=CC=C2)F)(O)O |
Computed by PubChem (NCBI)
Synonyms:
4-Benzyloxy-2,6-difluorophenylboronic acid, (4-(Benzyloxy)-2,6-difluorophenyl)boronic acid, (4-(Benzyloxy)-2,6-difluorophenyl)boronicacid, (2,6-difluoro-4-phenylmethoxyphenyl)boronic acid, [4-(Benzyloxy)-2,6-difluorophenyl]boronic acid, Boronic acid, [2,6-difluoro-4-(phenylmethoxy)phenyl]- (9CI), 4-(benzyloxy)-2,6-difluorophenylboronic acid, (4-Benzyloxy-2,6-difluoro-phenyl)boronic acid