cas: 338454-30-1 — see every product listed under this CAS number, including other names
(4-(Benzyloxy)-3-methylphenyl)boronic acid, 98% (CAS 338454-30-1) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F236737-5G |
| cas | 338454-30-1 |
| size | 5g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 5g | 247.85 Pln | |
| Fluorochem | 10g | 440.49 Pln | |
| Fluorochem | 25g | 976.76 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(3-methyl-4-phenylmethoxyphenyl)boronic acid (CAS 338454-30-1) is a chemical compound with the molecular formula C14H15BO3 and a molecular weight of 242.08 g/mol. IUPAC name: (3-methyl-4-phenylmethoxyphenyl)boronic acid. InChIKey: QPXFEWQLALNXEZ-UHFFFAOYSA-N.
| Molecular formula | C14H15BO3 |
|---|---|
| Molecular weight | 242.08 g/mol |
| IUPAC name | (3-methyl-4-phenylmethoxyphenyl)boronic acid |
| InChIKey | QPXFEWQLALNXEZ-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1)OCC2=CC=CC=C2)C)(O)O |
Computed by PubChem (NCBI)