cas: 956894-13-6 — see every product listed under this CAS number, including other names
(4-(Pentan-3-ylcarbamoyl)phenyl)boronic acid, 95% (CAS 956894-13-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F778126-250MG |
| cas | 956894-13-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 820.56 Pln | |
| Fluorochem | 1g | 1788.97 Pln | |
| Fluorochem | 5g | 6474.82 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
[4-(pentan-3-ylcarbamoyl)phenyl]boronic acid (CAS 956894-13-6) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: [4-(pentan-3-ylcarbamoyl)phenyl]boronic acid. InChIKey: KJQGCBCLYZDJGA-UHFFFAOYSA-N.
| Molecular formula | C12H18BNO3 |
|---|---|
| Molecular weight | 235.09 g/mol |
| IUPAC name | [4-(pentan-3-ylcarbamoyl)phenyl]boronic acid |
| InChIKey | KJQGCBCLYZDJGA-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(=O)NC(CC)CC)(O)O |
Computed by PubChem (NCBI)