Products 1309601-77-1

CAS 1309601-77-1 is the registry number for 5-Methoxypyridine-2-boronic acid pinacol ester, 96%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg, 100mg.

Structural formula: {0} (CAS {1})

5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine (CAS 1309601-77-1) is a chemical compound with the molecular formula C12H18BNO3 and a molecular weight of 235.09 g/mol. IUPAC name: 5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine. InChIKey: QUCFIMUSDWSHMN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H18BNO3
Molecular weight235.09 g/mol
IUPAC name5-methoxy-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
InChIKeyQUCFIMUSDWSHMN-UHFFFAOYSA-N
SMILESB1(OC(C(O1)(C)C)(C)C)C2=NC=C(C=C2)OC

Computed by PubChem (NCBI)