Products 229009-42-1
CAS 229009-42-1 appears in our catalog under these names: (4–(Piperidin–1–yl)phenyl)boronic acid, (4-(Piperidin-1-yl)phenyl)boronic acid, 97%, 97%, (4-(Piperidin-1-yl)phenyl)boronic acid, 97%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 5g, 10g, 25g.
(4-piperidin-1-ylphenyl)boronic acid;hydrochloride (CAS 229009-42-1) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: (4-piperidin-1-ylphenyl)boronic acid;hydrochloride. InChIKey: XJTAVEWPXXNWGK-UHFFFAOYSA-N.
| Molecular formula | C11H17BClNO2 |
|---|---|
| Molecular weight | 241.52 g/mol |
| IUPAC name | (4-piperidin-1-ylphenyl)boronic acid;hydrochloride |
| InChIKey | XJTAVEWPXXNWGK-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)N2CCCCC2)(O)O.Cl |
Computed by PubChem (NCBI)
Synonyms:
4-(Piperidino)phenylboronic acid hydrochloride, (4-(Piperidin-1-yl)phenyl)boronic acid hydrochloride, (4-piperidin-1-ylphenyl)boronic acid;hydrochloride, 4-(1-Piperidyl)phenylboronic Acid, (4-(Piperidin-1-yl)phenyl)boronicacidhydrochloride, [4-(1-piperidyl)phenyl]boronic acid;hydrochloride, [4-(Piperidin-1-yl)phenyl]boronic acid--hydrogen chloride (1/1)