Products 1704073-39-1
CAS 1704073-39-1 is the registry number for (4–(1–(Cyclopropylamino)ethyl)phenyl)boronic acid hydrochloride. Offered by: GLPBio. Available pack sizes: 1g.
[4-[1-(cyclopropylamino)ethyl]phenyl]boronic acid;hydrochloride (CAS 1704073-39-1) is a chemical compound with the molecular formula C11H17BClNO2 and a molecular weight of 241.52 g/mol. IUPAC name: [4-[1-(cyclopropylamino)ethyl]phenyl]boronic acid;hydrochloride. InChIKey: DDXXRBYMTVSPAM-UHFFFAOYSA-N.
| Molecular formula | C11H17BClNO2 |
|---|---|
| Molecular weight | 241.52 g/mol |
| IUPAC name | [4-[1-(cyclopropylamino)ethyl]phenyl]boronic acid;hydrochloride |
| InChIKey | DDXXRBYMTVSPAM-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)C(C)NC2CC2)(O)O.Cl |
Computed by PubChem (NCBI)